C21H24N2O2 — CID 24860362
3-hexyl-5,5-diphenylimidazolidine-2,4-dione (PubChem CID 24860362) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 3-hexyl-5,5-diphenylimidazolidine-2,4-dione.
| Compound Name | 3-hexyl-5,5-diphenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 24860362 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 3-hexyl-5,5-diphenylimidazolidine-2,4-dione |
| SMILES | CCCCCCN1C(=O)NC(c2ccccc2)(c2ccccc2)C1=O |
| InChI | InChI=1S/C21H24N2O2/c1-2-3-4-11-16-23-19(24)21(22-20(23)25,17-12-7-5-8-13-17)18-14-9-6-10-15-18/h5-10,12-15H,2-4,11,16H2,1H3,(H,22,25) |
| InChIKey | JYVFPSMCKDDFLU-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|