C28H40N3O4P — CID 67922072
3-[6-[[di(propan-2-yl)amino]-methoxyphosphanyl]oxyhexyl]-5,5-diphenylimidazolidine-2,4-dione (PubChem CID 67922072) has the molecular formula C28H40N3O4P and a molecular weight of 513.62 g/mol. Its IUPAC name is 3-[6-[[di(propan-2-yl)amino]-methoxyphosphanyl]oxyhexyl]-5,5-diphenylimidazolidine-2,4-dione.
| Compound Name | 3-[6-[[di(propan-2-yl)amino]-methoxyphosphanyl]oxyhexyl]-5,5-diphenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 67922072 |
| Molecular Formula | C28H40N3O4P |
| Molecular Weight | 513.62 g/mol |
| Exact Mass | 513.28 |
| IUPAC Name | 3-[6-[[di(propan-2-yl)amino]-methoxyphosphanyl]oxyhexyl]-5,5-diphenylimidazolidine-2,4-dione |
| SMILES | COP(OCCCCCCN1C(=O)NC(c2ccccc2)(c2ccccc2)C1=O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C28H40N3O4P/c1-22(2)31(23(3)4)36(34-5)35-21-15-7-6-14-20-30-26(32)28(29-27(30)33,24-16-10-8-11-17-24)25-18-12-9-13-19-25/h8-13,16-19,22-23H,6-7,14-15,20-21H2,1-5H3,(H,29,33) |
| InChIKey | IOJMLFWCZXQIMH-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.62 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|