C29H30N2O4 — CID 2965830
3-[4-(2-methoxy-4-prop-1-enylphenoxy)butyl]-5,5-diphenylimidazolidine-2,4-dione (PubChem CID 2965830) has the molecular formula C29H30N2O4 and a molecular weight of 470.57 g/mol. Its IUPAC name is 3-[4-(2-methoxy-4-prop-1-enylphenoxy)butyl]-5,5-diphenylimidazolidine-2,4-dione.
| Compound Name | 3-[4-(2-methoxy-4-prop-1-enylphenoxy)butyl]-5,5-diphenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 2965830 |
| Molecular Formula | C29H30N2O4 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 3-[4-(2-methoxy-4-prop-1-enylphenoxy)butyl]-5,5-diphenylimidazolidine-2,4-dione |
| SMILES | CC=Cc1ccc(OCCCCN2C(=O)NC(c3ccccc3)(c3ccccc3)C2=O)c(OC)c1 |
| InChI | InChI=1S/C29H30N2O4/c1-3-12-22-17-18-25(26(21-22)34-2)35-20-11-10-19-31-27(32)29(30-28(31)33,23-13-6-4-7-14-23)24-15-8-5-9-16-24/h3-9,12-18,21H,10-11,19-20H2,1-2H3,(H,30,33) |
| InChIKey | GNDLEBVLTYWXBH-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|