C20H23FO3 — CID 2292081
1-[4-(4-fluorophenoxy)butoxy]-2-methoxy-4-[(E)-prop-1-enyl]benzene (PubChem CID 2292081) has the molecular formula C20H23FO3 and a molecular weight of 330.40 g/mol. Its IUPAC name is 1-[4-(4-fluorophenoxy)butoxy]-2-methoxy-4-[(E)-prop-1-enyl]benzene.
| Compound Name | 1-[4-(4-fluorophenoxy)butoxy]-2-methoxy-4-[(E)-prop-1-enyl]benzene |
|---|---|
| PubChem CID | 2292081 |
| Molecular Formula | C20H23FO3 |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 1-[4-(4-fluorophenoxy)butoxy]-2-methoxy-4-[(E)-prop-1-enyl]benzene |
| SMILES | C/C=C/c1ccc(OCCCCOc2ccc(F)cc2)c(OC)c1 |
| InChI | InChI=1S/C20H23FO3/c1-3-6-16-7-12-19(20(15-16)22-2)24-14-5-4-13-23-18-10-8-17(21)9-11-18/h3,6-12,15H,4-5,13-14H2,1-2H3/b6-3+ |
| InChIKey | UBDJSKREZFYTSY-ZZXKWVIFSA-N |
| XLogP | 5.11 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|