C12H17NO2 — CID 62582661
2-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]ethanamine (PubChem CID 62582661) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 2-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]ethanamine.
| Compound Name | 2-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]ethanamine |
|---|---|
| PubChem CID | 62582661 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 2-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]ethanamine |
| SMILES | C/C=C/c1ccc(OCCN)c(OC)c1 |
| InChI | InChI=1S/C12H17NO2/c1-3-4-10-5-6-11(15-8-7-13)12(9-10)14-2/h3-6,9H,7-8,13H2,1-2H3/b4-3+ |
| InChIKey | AZRJYKNYHLFEIO-ONEGZZNKSA-N |
| XLogP | 2.07 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |