C27H34N2O6 — CID 126635810
(1E,6E)-1-[3,4-bis(2-aminoethoxy)phenyl]-7-(4-ethoxy-3-methoxyphenyl)-4-methylhepta-1,6-diene-3,5-dione (PubChem CID 126635810) has the molecular formula C27H34N2O6 and a molecular weight of 482.58 g/mol. Its IUPAC name is (1E,6E)-1-[3,4-bis(2-aminoethoxy)phenyl]-7-(4-ethoxy-3-methoxyphenyl)-4-methylhepta-1,6-diene-3,5-dione.
| Compound Name | (1E,6E)-1-[3,4-bis(2-aminoethoxy)phenyl]-7-(4-ethoxy-3-methoxyphenyl)-4-methylhepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 126635810 |
| Molecular Formula | C27H34N2O6 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | (1E,6E)-1-[3,4-bis(2-aminoethoxy)phenyl]-7-(4-ethoxy-3-methoxyphenyl)-4-methylhepta-1,6-diene-3,5-dione |
| SMILES | CCOc1ccc(/C=C/C(=O)C(C)C(=O)/C=C/c2ccc(OCCN)c(OCCN)c2)cc1OC |
| InChI | InChI=1S/C27H34N2O6/c1-4-33-24-11-7-20(17-26(24)32-3)5-9-22(30)19(2)23(31)10-6-21-8-12-25(34-15-13-28)27(18-21)35-16-14-29/h5-12,17-19H,4,13-16,28-29H2,1-3H3/b9-5+,10-6+ |
| InChIKey | FMRQBIZDSVLKMY-NXZHAISVSA-N |
| XLogP | 3.27 |
| TPSA | 123.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|