C18H29NO2 — CID 76946730
N-[2-(2-methoxy-4-prop-1-enylphenoxy)ethyl]-3,3-dimethylbutan-1-amine (PubChem CID 76946730) has the molecular formula C18H29NO2 and a molecular weight of 291.44 g/mol. Its IUPAC name is N-[2-(2-methoxy-4-prop-1-enylphenoxy)ethyl]-3,3-dimethylbutan-1-amine.
| Compound Name | N-[2-(2-methoxy-4-prop-1-enylphenoxy)ethyl]-3,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 76946730 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | N-[2-(2-methoxy-4-prop-1-enylphenoxy)ethyl]-3,3-dimethylbutan-1-amine |
| SMILES | CC=Cc1ccc(OCCNCCC(C)(C)C)c(OC)c1 |
| InChI | InChI=1S/C18H29NO2/c1-6-7-15-8-9-16(17(14-15)20-5)21-13-12-19-11-10-18(2,3)4/h6-9,14,19H,10-13H2,1-5H3 |
| InChIKey | BBHYVNWRCJRGDH-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|