C25H31NO7 — CID 11236443
(E)-3-[4-[2-[[2-hydroxy-3-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]propyl]amino]ethoxy]-3-methoxyphenyl]prop-2-enoic acid (PubChem CID 11236443) has the molecular formula C25H31NO7 and a molecular weight of 457.52 g/mol. Its IUPAC name is (E)-3-[4-[2-[[2-hydroxy-3-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]propyl]amino]ethoxy]-3-methoxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[2-[[2-hydroxy-3-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]propyl]amino]ethoxy]-3-methoxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 11236443 |
| Molecular Formula | C25H31NO7 |
| Molecular Weight | 457.52 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | (E)-3-[4-[2-[[2-hydroxy-3-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]propyl]amino]ethoxy]-3-methoxyphenyl]prop-2-enoic acid |
| SMILES | C/C=C/c1ccc(OCC(O)CNCCOc2ccc(/C=C/C(=O)O)cc2OC)c(OC)c1 |
| InChI | InChI=1S/C25H31NO7/c1-4-5-18-6-10-22(24(14-18)31-3)33-17-20(27)16-26-12-13-32-21-9-7-19(8-11-25(28)29)15-23(21)30-2/h4-11,14-15,20,26-27H,12-13,16-17H2,1-3H3,(H,28,29)/b5-4+,11-8+ |
| InChIKey | WNWVHTQZLLCHBA-OCJIRGAFSA-N |
| XLogP | 3.24 |
| TPSA | 106.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.52 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|