C23H29NO7 — CID 11144502
4-[2-[[2-hydroxy-3-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]propyl]amino]ethoxy]-3-methoxybenzoic acid (PubChem CID 11144502) has the molecular formula C23H29NO7 and a molecular weight of 431.49 g/mol. Its IUPAC name is 4-[2-[[2-hydroxy-3-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]propyl]amino]ethoxy]-3-methoxybenzoic acid.
| Compound Name | 4-[2-[[2-hydroxy-3-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]propyl]amino]ethoxy]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 11144502 |
| Molecular Formula | C23H29NO7 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | 4-[2-[[2-hydroxy-3-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]propyl]amino]ethoxy]-3-methoxybenzoic acid |
| SMILES | C/C=C/c1ccc(OCC(O)CNCCOc2ccc(C(=O)O)cc2OC)c(OC)c1 |
| InChI | InChI=1S/C23H29NO7/c1-4-5-16-6-8-20(21(12-16)28-2)31-15-18(25)14-24-10-11-30-19-9-7-17(23(26)27)13-22(19)29-3/h4-9,12-13,18,24-25H,10-11,14-15H2,1-3H3,(H,26,27)/b5-4+ |
| InChIKey | DEWFXHVBQWKXIT-SNAWJCMRSA-N |
| XLogP | 2.84 |
| TPSA | 106.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|