C20H32NO3+ — CID 2510300
(2R)-1-(azocan-1-ium-1-yl)-3-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]propan-2-ol (PubChem CID 2510300) has the molecular formula C20H32NO3+ and a molecular weight of 334.48 g/mol. Its IUPAC name is (2R)-1-(azocan-1-ium-1-yl)-3-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]propan-2-ol.
| Compound Name | (2R)-1-(azocan-1-ium-1-yl)-3-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 2510300 |
| Molecular Formula | C20H32NO3+ |
| Molecular Weight | 334.48 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | (2R)-1-(azocan-1-ium-1-yl)-3-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]propan-2-ol |
| SMILES | C/C=C/c1ccc(OC[C@H](O)C[NH+]2CCCCCCC2)c(OC)c1 |
| InChI | InChI=1S/C20H31NO3/c1-3-9-17-10-11-19(20(14-17)23-2)24-16-18(22)15-21-12-7-5-4-6-8-13-21/h3,9-11,14,18,22H,4-8,12-13,15-16H2,1-2H3/p+1/b9-3+/t18-/m1/s1 |
| InChIKey | FENAEKBBZNBOCY-KDEAJPOZSA-O |
| XLogP | 2.32 |
| TPSA | 43.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.48 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |