C21H31NO8 — CID 73243580
1-[2-(hydroxymethyl)piperidin-1-yl]-3-(2-methoxy-4-prop-1-enylphenoxy)propan-2-ol;oxalic acid (PubChem CID 73243580) has the molecular formula C21H31NO8 and a molecular weight of 425.48 g/mol. Its IUPAC name is 1-[2-(hydroxymethyl)piperidin-1-yl]-3-(2-methoxy-4-prop-1-enylphenoxy)propan-2-ol;oxalic acid.
| Compound Name | 1-[2-(hydroxymethyl)piperidin-1-yl]-3-(2-methoxy-4-prop-1-enylphenoxy)propan-2-ol;oxalic acid |
|---|---|
| PubChem CID | 73243580 |
| Molecular Formula | C21H31NO8 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | 1-[2-(hydroxymethyl)piperidin-1-yl]-3-(2-methoxy-4-prop-1-enylphenoxy)propan-2-ol;oxalic acid |
| SMILES | CC=Cc1ccc(OCC(O)CN2CCCCC2CO)c(OC)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H29NO4.C2H2O4/c1-3-6-15-8-9-18(19(11-15)23-2)24-14-17(22)12-20-10-5-4-7-16(20)13-21;3-1(4)2(5)6/h3,6,8-9,11,16-17,21-22H,4-5,7,10,12-14H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | SYQGGVLNXTUYEK-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 136.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|