C19H30ClNO3 — CID 2997672
hydron;1-(2-methoxy-4-prop-2-enylphenoxy)-3-(2-methylpiperidin-1-yl)propan-2-ol;chloride (PubChem CID 2997672) has the molecular formula C19H30ClNO3 and a molecular weight of 355.91 g/mol. Its IUPAC name is hydron;1-(2-methoxy-4-prop-2-enylphenoxy)-3-(2-methylpiperidin-1-yl)propan-2-ol;chloride.
| Compound Name | hydron;1-(2-methoxy-4-prop-2-enylphenoxy)-3-(2-methylpiperidin-1-yl)propan-2-ol;chloride |
|---|---|
| PubChem CID | 2997672 |
| Molecular Formula | C19H30ClNO3 |
| Molecular Weight | 355.91 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | hydron;1-(2-methoxy-4-prop-2-enylphenoxy)-3-(2-methylpiperidin-1-yl)propan-2-ol;chloride |
| SMILES | C=CCc1ccc(OCC(O)CN2CCCCC2C)c(OC)c1.[Cl-].[H+] |
| InChI | InChI=1S/C19H29NO3.ClH/c1-4-7-16-9-10-18(19(12-16)22-3)23-14-17(21)13-20-11-6-5-8-15(20)2;/h4,9-10,12,15,17,21H,1,5-8,11,13-14H2,2-3H3;1H |
| InChIKey | UBISLTRHTJZHTI-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.91 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|