C23H31NO5 — CID 95352235
3-[(2R)-2-hydroxy-3-(2-methoxy-4-prop-2-enylphenoxy)propyl]-3-azaspiro[5.5]undecane-2,4-dione (PubChem CID 95352235) has the molecular formula C23H31NO5 and a molecular weight of 401.50 g/mol. Its IUPAC name is 3-[(2R)-2-hydroxy-3-(2-methoxy-4-prop-2-enylphenoxy)propyl]-3-azaspiro[5.5]undecane-2,4-dione.
| Compound Name | 3-[(2R)-2-hydroxy-3-(2-methoxy-4-prop-2-enylphenoxy)propyl]-3-azaspiro[5.5]undecane-2,4-dione |
|---|---|
| PubChem CID | 95352235 |
| Molecular Formula | C23H31NO5 |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 3-[(2R)-2-hydroxy-3-(2-methoxy-4-prop-2-enylphenoxy)propyl]-3-azaspiro[5.5]undecane-2,4-dione |
| SMILES | C=CCc1ccc(OC[C@H](O)CN2C(=O)CC3(CCCCC3)CC2=O)c(OC)c1 |
| InChI | InChI=1S/C23H31NO5/c1-3-7-17-8-9-19(20(12-17)28-2)29-16-18(25)15-24-21(26)13-23(14-22(24)27)10-5-4-6-11-23/h3,8-9,12,18,25H,1,4-7,10-11,13-16H2,2H3/t18-/m1/s1 |
| InChIKey | NIWZMZZFIPFSSP-GOSISDBHSA-N |
| XLogP | 3.26 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|