C21H29NO5 — CID 56509405
3-[2-hydroxy-3-[(4-methoxyphenyl)methoxy]propyl]-3-azaspiro[5.5]undecane-2,4-dione (PubChem CID 56509405) has the molecular formula C21H29NO5 and a molecular weight of 375.47 g/mol. Its IUPAC name is 3-[2-hydroxy-3-[(4-methoxyphenyl)methoxy]propyl]-3-azaspiro[5.5]undecane-2,4-dione.
| Compound Name | 3-[2-hydroxy-3-[(4-methoxyphenyl)methoxy]propyl]-3-azaspiro[5.5]undecane-2,4-dione |
|---|---|
| PubChem CID | 56509405 |
| Molecular Formula | C21H29NO5 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | 3-[2-hydroxy-3-[(4-methoxyphenyl)methoxy]propyl]-3-azaspiro[5.5]undecane-2,4-dione |
| SMILES | COc1ccc(COCC(O)CN2C(=O)CC3(CCCCC3)CC2=O)cc1 |
| InChI | InChI=1S/C21H29NO5/c1-26-18-7-5-16(6-8-18)14-27-15-17(23)13-22-19(24)11-21(12-20(22)25)9-3-2-4-10-21/h5-8,17,23H,2-4,9-15H2,1H3 |
| InChIKey | RGHMGHQVAKXJPR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|