C20H26ClNO4 — CID 97012071
3-[(2R)-3-[(4-chlorophenyl)methoxy]-2-hydroxypropyl]-3-azaspiro[5.5]undecane-2,4-dione (PubChem CID 97012071) has the molecular formula C20H26ClNO4 and a molecular weight of 379.88 g/mol. Its IUPAC name is 3-[(2R)-3-[(4-chlorophenyl)methoxy]-2-hydroxypropyl]-3-azaspiro[5.5]undecane-2,4-dione.
| Compound Name | 3-[(2R)-3-[(4-chlorophenyl)methoxy]-2-hydroxypropyl]-3-azaspiro[5.5]undecane-2,4-dione |
|---|---|
| PubChem CID | 97012071 |
| Molecular Formula | C20H26ClNO4 |
| Molecular Weight | 379.88 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 3-[(2R)-3-[(4-chlorophenyl)methoxy]-2-hydroxypropyl]-3-azaspiro[5.5]undecane-2,4-dione |
| SMILES | O=C1CC2(CCCCC2)CC(=O)N1C[C@@H](O)COCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H26ClNO4/c21-16-6-4-15(5-7-16)13-26-14-17(23)12-22-18(24)10-20(11-19(22)25)8-2-1-3-9-20/h4-7,17,23H,1-3,8-14H2/t17-/m1/s1 |
| InChIKey | DHHJOPFYQNSQBZ-QGZVFWFLSA-N |
| XLogP | 3.32 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.88 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|