C18H28ClNO3 — CID 111333431
1-[(4-chlorophenyl)methoxy]-3-[2-(1-hydroxypropyl)piperidin-1-yl]propan-2-ol (PubChem CID 111333431) has the molecular formula C18H28ClNO3 and a molecular weight of 341.88 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methoxy]-3-[2-(1-hydroxypropyl)piperidin-1-yl]propan-2-ol.
| Compound Name | 1-[(4-chlorophenyl)methoxy]-3-[2-(1-hydroxypropyl)piperidin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 111333431 |
| Molecular Formula | C18H28ClNO3 |
| Molecular Weight | 341.88 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | 1-[(4-chlorophenyl)methoxy]-3-[2-(1-hydroxypropyl)piperidin-1-yl]propan-2-ol |
| SMILES | CCC(O)C1CCCCN1CC(O)COCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H28ClNO3/c1-2-18(22)17-5-3-4-10-20(17)11-16(21)13-23-12-14-6-8-15(19)9-7-14/h6-9,16-18,21-22H,2-5,10-13H2,1H3 |
| InChIKey | HPKUNSIWKOCOBS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.88 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |