C23H29Cl2NO2 — CID 7746013
(2S)-1-[bis(4-chlorophenyl)methoxy]-3-[(2R)-2-ethylpiperidin-1-yl]propan-2-ol (PubChem CID 7746013) has the molecular formula C23H29Cl2NO2 and a molecular weight of 422.40 g/mol. Its IUPAC name is (2S)-1-[bis(4-chlorophenyl)methoxy]-3-[(2R)-2-ethylpiperidin-1-yl]propan-2-ol.
| Compound Name | (2S)-1-[bis(4-chlorophenyl)methoxy]-3-[(2R)-2-ethylpiperidin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 7746013 |
| Molecular Formula | C23H29Cl2NO2 |
| Molecular Weight | 422.40 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | (2S)-1-[bis(4-chlorophenyl)methoxy]-3-[(2R)-2-ethylpiperidin-1-yl]propan-2-ol |
| SMILES | CC[C@@H]1CCCCN1C[C@H](O)COC(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H29Cl2NO2/c1-2-21-5-3-4-14-26(21)15-22(27)16-28-23(17-6-10-19(24)11-7-17)18-8-12-20(25)13-9-18/h6-13,21-23,27H,2-5,14-16H2,1H3/t21-,22+/m1/s1 |
| InChIKey | FQCKFBWOIYBMAE-YADHBBJMSA-N |
| XLogP | 5.72 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.40 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |