C15H22Cl2NO3- — CID 21236718
1-(4-chlorophenoxy)-3-[2-(hydroxymethyl)piperidin-1-yl]propan-2-ol chloride (PubChem CID 21236718) has the molecular formula C15H22Cl2NO3- and a molecular weight of 335.25 g/mol. Its IUPAC name is 1-(4-chlorophenoxy)-3-[2-(hydroxymethyl)piperidin-1-yl]propan-2-ol chloride.
| Compound Name | 1-(4-chlorophenoxy)-3-[2-(hydroxymethyl)piperidin-1-yl]propan-2-ol chloride |
|---|---|
| PubChem CID | 21236718 |
| Molecular Formula | C15H22Cl2NO3- |
| Molecular Weight | 335.25 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 1-(4-chlorophenoxy)-3-[2-(hydroxymethyl)piperidin-1-yl]propan-2-ol chloride |
| SMILES | OCC1CCCCN1CC(O)COc1ccc(Cl)cc1.[Cl-] |
| InChI | InChI=1S/C15H22ClNO3.ClH/c16-12-4-6-15(7-5-12)20-11-14(19)9-17-8-2-1-3-13(17)10-18;/h4-7,13-14,18-19H,1-3,8-11H2;1H/p-1 |
| InChIKey | KMSPEGVTUUGNMW-UHFFFAOYSA-M |
| XLogP | -1.07 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.25 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |