C15H22N2O5 — CID 7998318
(2S)-1-[(2S)-2-(hydroxymethyl)piperidin-1-yl]-3-(3-nitrophenoxy)propan-2-ol (PubChem CID 7998318) has the molecular formula C15H22N2O5 and a molecular weight of 310.35 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-(hydroxymethyl)piperidin-1-yl]-3-(3-nitrophenoxy)propan-2-ol.
| Compound Name | (2S)-1-[(2S)-2-(hydroxymethyl)piperidin-1-yl]-3-(3-nitrophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 7998318 |
| Molecular Formula | C15H22N2O5 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | (2S)-1-[(2S)-2-(hydroxymethyl)piperidin-1-yl]-3-(3-nitrophenoxy)propan-2-ol |
| SMILES | O=[N+]([O-])c1cccc(OC[C@@H](O)CN2CCCC[C@H]2CO)c1 |
| InChI | InChI=1S/C15H22N2O5/c18-10-13-4-1-2-7-16(13)9-14(19)11-22-15-6-3-5-12(8-15)17(20)21/h3,5-6,8,13-14,18-19H,1-2,4,7,9-11H2/t13-,14-/m0/s1 |
| InChIKey | RZQYBCXNCIZORR-KBPBESRZSA-N |
| XLogP | 1.18 |
| TPSA | 96.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|