C18H27NO4 — CID 7998324
methyl 3-[(2S)-3-[(2R)-2-ethylpiperidin-1-yl]-2-hydroxypropoxy]benzoate (PubChem CID 7998324) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is methyl 3-[(2S)-3-[(2R)-2-ethylpiperidin-1-yl]-2-hydroxypropoxy]benzoate.
| Compound Name | methyl 3-[(2S)-3-[(2R)-2-ethylpiperidin-1-yl]-2-hydroxypropoxy]benzoate |
|---|---|
| PubChem CID | 7998324 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | methyl 3-[(2S)-3-[(2R)-2-ethylpiperidin-1-yl]-2-hydroxypropoxy]benzoate |
| SMILES | CC[C@@H]1CCCCN1C[C@H](O)COc1cccc(C(=O)OC)c1 |
| InChI | InChI=1S/C18H27NO4/c1-3-15-8-4-5-10-19(15)12-16(20)13-23-17-9-6-7-14(11-17)18(21)22-2/h6-7,9,11,15-16,20H,3-5,8,10,12-13H2,1-2H3/t15-,16+/m1/s1 |
| InChIKey | OXFUKHSHXROZHB-CVEARBPZSA-N |
| XLogP | 2.48 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |