C20H27NO4 — CID 42335950
7-[(2R)-3-[(2S)-2-ethylpiperidin-1-yl]-2-hydroxypropoxy]-4-methylchromen-2-one (PubChem CID 42335950) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is 7-[(2R)-3-[(2S)-2-ethylpiperidin-1-yl]-2-hydroxypropoxy]-4-methylchromen-2-one.
| Compound Name | 7-[(2R)-3-[(2S)-2-ethylpiperidin-1-yl]-2-hydroxypropoxy]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 42335950 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 7-[(2R)-3-[(2S)-2-ethylpiperidin-1-yl]-2-hydroxypropoxy]-4-methylchromen-2-one |
| SMILES | CC[C@H]1CCCCN1C[C@@H](O)COc1ccc2c(C)cc(=O)oc2c1 |
| InChI | InChI=1S/C20H27NO4/c1-3-15-6-4-5-9-21(15)12-16(22)13-24-17-7-8-18-14(2)10-20(23)25-19(18)11-17/h7-8,10-11,15-16,22H,3-6,9,12-13H2,1-2H3/t15-,16+/m0/s1 |
| InChIKey | VWTJHCNAEQPSPB-JKSUJKDBSA-N |
| XLogP | 3.11 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|