C19H26NO5+ — CID 7223064
7-[(2S)-3-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]-2-hydroxypropoxy]-4-methylchromen-2-one (PubChem CID 7223064) has the molecular formula C19H26NO5+ and a molecular weight of 348.42 g/mol. Its IUPAC name is 7-[(2S)-3-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]-2-hydroxypropoxy]-4-methylchromen-2-one.
| Compound Name | 7-[(2S)-3-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]-2-hydroxypropoxy]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 7223064 |
| Molecular Formula | C19H26NO5+ |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 7-[(2S)-3-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]-2-hydroxypropoxy]-4-methylchromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(OC[C@@H](O)C[NH+]3C[C@@H](C)O[C@H](C)C3)ccc12 |
| InChI | InChI=1S/C19H25NO5/c1-12-6-19(22)25-18-7-16(4-5-17(12)18)23-11-15(21)10-20-8-13(2)24-14(3)9-20/h4-7,13-15,21H,8-11H2,1-3H3/p+1/t13-,14-,15+/m1/s1 |
| InChIKey | AGJBSEHSHCYFEH-KFWWJZLASA-O |
| XLogP | 0.53 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|