C18H18O5S — CID 109413306
7-[2-hydroxy-3-(thiophen-2-ylmethoxy)propoxy]-4-methylchromen-2-one (PubChem CID 109413306) has the molecular formula C18H18O5S and a molecular weight of 346.40 g/mol. Its IUPAC name is 7-[2-hydroxy-3-(thiophen-2-ylmethoxy)propoxy]-4-methylchromen-2-one.
| Compound Name | 7-[2-hydroxy-3-(thiophen-2-ylmethoxy)propoxy]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 109413306 |
| Molecular Formula | C18H18O5S |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 7-[2-hydroxy-3-(thiophen-2-ylmethoxy)propoxy]-4-methylchromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(OCC(O)COCc3cccs3)ccc12 |
| InChI | InChI=1S/C18H18O5S/c1-12-7-18(20)23-17-8-14(4-5-16(12)17)22-10-13(19)9-21-11-15-3-2-6-24-15/h2-8,13,19H,9-11H2,1H3 |
| InChIKey | SRTFAEBNCPQQBF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|