C16H20O5 — CID 89150777
7-(5,6-dihydroxyhexoxy)-4-methylchromen-2-one (PubChem CID 89150777) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is 7-(5,6-dihydroxyhexoxy)-4-methylchromen-2-one.
| Compound Name | 7-(5,6-dihydroxyhexoxy)-4-methylchromen-2-one |
|---|---|
| PubChem CID | 89150777 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 7-(5,6-dihydroxyhexoxy)-4-methylchromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(OCCCCC(O)CO)ccc12 |
| InChI | InChI=1S/C16H20O5/c1-11-8-16(19)21-15-9-13(5-6-14(11)15)20-7-3-2-4-12(18)10-17/h5-6,8-9,12,17-18H,2-4,7,10H2,1H3 |
| InChIKey | UOPIHVRSMHHAGE-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|