C16H17N3O3 — CID 53320472
4-methyl-7-[4-(1,2,4-triazol-1-yl)butoxy]chromen-2-one (PubChem CID 53320472) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is 4-methyl-7-[4-(1,2,4-triazol-1-yl)butoxy]chromen-2-one.
| Compound Name | 4-methyl-7-[4-(1,2,4-triazol-1-yl)butoxy]chromen-2-one |
|---|---|
| PubChem CID | 53320472 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 4-methyl-7-[4-(1,2,4-triazol-1-yl)butoxy]chromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(OCCCCn3cncn3)ccc12 |
| InChI | InChI=1S/C16H17N3O3/c1-12-8-16(20)22-15-9-13(4-5-14(12)15)21-7-3-2-6-19-11-17-10-18-19/h4-5,8-11H,2-3,6-7H2,1H3 |
| InChIKey | KPHKIPNDVJAQJG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 70.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|