C15H14N4O6 — CID 141249896
[4-methyl-2-oxo-7-[3-(1,2,4-triazol-1-yl)propoxy]chromen-3-yl] nitrate (PubChem CID 141249896) has the molecular formula C15H14N4O6 and a molecular weight of 346.30 g/mol. Its IUPAC name is [4-methyl-2-oxo-7-[3-(1,2,4-triazol-1-yl)propoxy]chromen-3-yl] nitrate.
| Compound Name | [4-methyl-2-oxo-7-[3-(1,2,4-triazol-1-yl)propoxy]chromen-3-yl] nitrate |
|---|---|
| PubChem CID | 141249896 |
| Molecular Formula | C15H14N4O6 |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | [4-methyl-2-oxo-7-[3-(1,2,4-triazol-1-yl)propoxy]chromen-3-yl] nitrate |
| SMILES | Cc1c(O[N+](=O)[O-])c(=O)oc2cc(OCCCn3cncn3)ccc12 |
| InChI | InChI=1S/C15H14N4O6/c1-10-12-4-3-11(23-6-2-5-18-9-16-8-17-18)7-13(12)24-15(20)14(10)25-19(21)22/h3-4,7-9H,2,5-6H2,1H3 |
| InChIKey | UBVIOLNIXMBUMT-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 122.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|