C20H26N2O6 — CID 155546201
3-[4-[(3,4-dimethyl-2-oxochromen-7-yl)oxymethyl]piperidin-1-yl]propyl nitrate (PubChem CID 155546201) has the molecular formula C20H26N2O6 and a molecular weight of 390.44 g/mol. Its IUPAC name is 3-[4-[(3,4-dimethyl-2-oxochromen-7-yl)oxymethyl]piperidin-1-yl]propyl nitrate.
| Compound Name | 3-[4-[(3,4-dimethyl-2-oxochromen-7-yl)oxymethyl]piperidin-1-yl]propyl nitrate |
|---|---|
| PubChem CID | 155546201 |
| Molecular Formula | C20H26N2O6 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 3-[4-[(3,4-dimethyl-2-oxochromen-7-yl)oxymethyl]piperidin-1-yl]propyl nitrate |
| SMILES | Cc1c(C)c2ccc(OCC3CCN(CCCO[N+](=O)[O-])CC3)cc2oc1=O |
| InChI | InChI=1S/C20H26N2O6/c1-14-15(2)20(23)28-19-12-17(4-5-18(14)19)26-13-16-6-9-21(10-7-16)8-3-11-27-22(24)25/h4-5,12,16H,3,6-11,13H2,1-2H3 |
| InChIKey | OYUDOWGNEYPOED-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 95.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|