C25H28BrClN2O3 — CID 88671369
3-(bromomethyl)-7-[3-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]propoxy]-4-methylchromen-2-one (PubChem CID 88671369) has the molecular formula C25H28BrClN2O3 and a molecular weight of 519.87 g/mol. Its IUPAC name is 3-(bromomethyl)-7-[3-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]propoxy]-4-methylchromen-2-one.
| Compound Name | 3-(bromomethyl)-7-[3-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]propoxy]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 88671369 |
| Molecular Formula | C25H28BrClN2O3 |
| Molecular Weight | 519.87 g/mol |
| Exact Mass | 518.10 |
| IUPAC Name | 3-(bromomethyl)-7-[3-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]propoxy]-4-methylchromen-2-one |
| SMILES | Cc1c(CBr)c(=O)oc2cc(OCCCN3CCN(Cc4ccc(Cl)cc4)CC3)ccc12 |
| InChI | InChI=1S/C25H28BrClN2O3/c1-18-22-8-7-21(15-24(22)32-25(30)23(18)16-26)31-14-2-9-28-10-12-29(13-11-28)17-19-3-5-20(27)6-4-19/h3-8,15H,2,9-14,16-17H2,1H3 |
| InChIKey | ROTNFLUVNSWUJT-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.87 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|