C25H30ClN3O2 — CID 23330456
8-[3-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]propoxy]-1,4-dimethylquinolin-2-one (PubChem CID 23330456) has the molecular formula C25H30ClN3O2 and a molecular weight of 439.99 g/mol. Its IUPAC name is 8-[3-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]propoxy]-1,4-dimethylquinolin-2-one.
| Compound Name | 8-[3-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]propoxy]-1,4-dimethylquinolin-2-one |
|---|---|
| PubChem CID | 23330456 |
| Molecular Formula | C25H30ClN3O2 |
| Molecular Weight | 439.99 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 8-[3-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]propoxy]-1,4-dimethylquinolin-2-one |
| SMILES | Cc1cc(=O)n(C)c2c(OCCCN3CCN(Cc4ccc(Cl)cc4)CC3)cccc12 |
| InChI | InChI=1S/C25H30ClN3O2/c1-19-17-24(30)27(2)25-22(19)5-3-6-23(25)31-16-4-11-28-12-14-29(15-13-28)18-20-7-9-21(26)10-8-20/h3,5-10,17H,4,11-16,18H2,1-2H3 |
| InChIKey | SMBVOLSDRQSAEZ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.99 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|