C19H25ClN4O4 — CID 19012018
6-[4-[3-(5-chloro-2-hydroxyphenoxy)propyl]piperazin-1-yl]-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 19012018) has the molecular formula C19H25ClN4O4 and a molecular weight of 408.89 g/mol. Its IUPAC name is 6-[4-[3-(5-chloro-2-hydroxyphenoxy)propyl]piperazin-1-yl]-1,3-dimethylpyrimidine-2,4-dione.
| Compound Name | 6-[4-[3-(5-chloro-2-hydroxyphenoxy)propyl]piperazin-1-yl]-1,3-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 19012018 |
| Molecular Formula | C19H25ClN4O4 |
| Molecular Weight | 408.89 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 6-[4-[3-(5-chloro-2-hydroxyphenoxy)propyl]piperazin-1-yl]-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | Cn1c(N2CCN(CCCOc3cc(Cl)ccc3O)CC2)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C19H25ClN4O4/c1-21-17(13-18(26)22(2)19(21)27)24-9-7-23(8-10-24)6-3-11-28-16-12-14(20)4-5-15(16)25/h4-5,12-13,25H,3,6-11H2,1-2H3 |
| InChIKey | DXVLFBLSBHOQKH-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.89 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|