C25H30N4O7 — CID 67812530
ethyl 5-[3-[4-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)piperazin-1-yl]propoxy]-4-oxochromene-2-carboxylate (PubChem CID 67812530) has the molecular formula C25H30N4O7 and a molecular weight of 498.54 g/mol. Its IUPAC name is ethyl 5-[3-[4-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)piperazin-1-yl]propoxy]-4-oxochromene-2-carboxylate.
| Compound Name | ethyl 5-[3-[4-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)piperazin-1-yl]propoxy]-4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 67812530 |
| Molecular Formula | C25H30N4O7 |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | ethyl 5-[3-[4-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)piperazin-1-yl]propoxy]-4-oxochromene-2-carboxylate |
| SMILES | CCOC(=O)c1cc(=O)c2c(OCCCN3CCN(c4cc(=O)n(C)c(=O)n4C)CC3)cccc2o1 |
| InChI | InChI=1S/C25H30N4O7/c1-4-34-24(32)20-15-17(30)23-18(7-5-8-19(23)36-20)35-14-6-9-28-10-12-29(13-11-28)21-16-22(31)27(3)25(33)26(21)2/h5,7-8,15-16H,4,6,9-14H2,1-3H3 |
| InChIKey | NRFCNYONGFARKO-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 116.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|