C19H25ClN4O3 — CID 10385868
6-[4-[3-(3-chlorophenoxy)propyl]piperazin-1-yl]-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 10385868) has the molecular formula C19H25ClN4O3 and a molecular weight of 392.89 g/mol. Its IUPAC name is 6-[4-[3-(3-chlorophenoxy)propyl]piperazin-1-yl]-1,3-dimethylpyrimidine-2,4-dione.
| Compound Name | 6-[4-[3-(3-chlorophenoxy)propyl]piperazin-1-yl]-1,3-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10385868 |
| Molecular Formula | C19H25ClN4O3 |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 6-[4-[3-(3-chlorophenoxy)propyl]piperazin-1-yl]-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | Cn1c(N2CCN(CCCOc3cccc(Cl)c3)CC2)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C19H25ClN4O3/c1-21-17(14-18(25)22(2)19(21)26)24-10-8-23(9-11-24)7-4-12-27-16-6-3-5-15(20)13-16/h3,5-6,13-14H,4,7-12H2,1-2H3 |
| InChIKey | JSUKLRRBPDUPCF-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 59.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|