C20H25F3N4O3 — CID 19012156
1,3-dimethyl-6-[4-[3-[4-(trifluoromethyl)phenoxy]propyl]piperazin-1-yl]pyrimidine-2,4-dione (PubChem CID 19012156) has the molecular formula C20H25F3N4O3 and a molecular weight of 426.44 g/mol. Its IUPAC name is 1,3-dimethyl-6-[4-[3-[4-(trifluoromethyl)phenoxy]propyl]piperazin-1-yl]pyrimidine-2,4-dione.
| Compound Name | 1,3-dimethyl-6-[4-[3-[4-(trifluoromethyl)phenoxy]propyl]piperazin-1-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 19012156 |
| Molecular Formula | C20H25F3N4O3 |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 1,3-dimethyl-6-[4-[3-[4-(trifluoromethyl)phenoxy]propyl]piperazin-1-yl]pyrimidine-2,4-dione |
| SMILES | Cn1c(N2CCN(CCCOc3ccc(C(F)(F)F)cc3)CC2)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C20H25F3N4O3/c1-24-17(14-18(28)25(2)19(24)29)27-11-9-26(10-12-27)8-3-13-30-16-6-4-15(5-7-16)20(21,22)23/h4-7,14H,3,8-13H2,1-2H3 |
| InChIKey | IGQHFVIQXLZLHO-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 59.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|