C19H26Cl2N4O3 — CID 19011810
6-[4-[3-(2-chlorophenoxy)propyl]piperazin-1-yl]-1,3-dimethylpyrimidine-2,4-dione;hydrochloride (PubChem CID 19011810) has the molecular formula C19H26Cl2N4O3 and a molecular weight of 429.35 g/mol. Its IUPAC name is 6-[4-[3-(2-chlorophenoxy)propyl]piperazin-1-yl]-1,3-dimethylpyrimidine-2,4-dione;hydrochloride.
| Compound Name | 6-[4-[3-(2-chlorophenoxy)propyl]piperazin-1-yl]-1,3-dimethylpyrimidine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 19011810 |
| Molecular Formula | C19H26Cl2N4O3 |
| Molecular Weight | 429.35 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 6-[4-[3-(2-chlorophenoxy)propyl]piperazin-1-yl]-1,3-dimethylpyrimidine-2,4-dione;hydrochloride |
| SMILES | Cl.Cn1c(N2CCN(CCCOc3ccccc3Cl)CC2)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C19H25ClN4O3.ClH/c1-21-17(14-18(25)22(2)19(21)26)24-11-9-23(10-12-24)8-5-13-27-16-7-4-3-6-15(16)20;/h3-4,6-7,14H,5,8-13H2,1-2H3;1H |
| InChIKey | HIBGHNDOGCYJFE-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 59.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.35 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|