C31H36N4O8S — CID 67849734
1,3-dimethyl-6-[4-[3-[2-[3-(4-methylsulfanylphenyl)prop-2-enoyl]phenoxy]propyl]piperazin-1-yl]pyrimidine-2,4-dione;oxalic acid (PubChem CID 67849734) has the molecular formula C31H36N4O8S and a molecular weight of 624.72 g/mol. Its IUPAC name is 1,3-dimethyl-6-[4-[3-[2-[3-(4-methylsulfanylphenyl)prop-2-enoyl]phenoxy]propyl]piperazin-1-yl]pyrimidine-2,4-dione;oxalic acid.
| Compound Name | 1,3-dimethyl-6-[4-[3-[2-[3-(4-methylsulfanylphenyl)prop-2-enoyl]phenoxy]propyl]piperazin-1-yl]pyrimidine-2,4-dione;oxalic acid |
|---|---|
| PubChem CID | 67849734 |
| Molecular Formula | C31H36N4O8S |
| Molecular Weight | 624.72 g/mol |
| Exact Mass | 624.23 |
| IUPAC Name | 1,3-dimethyl-6-[4-[3-[2-[3-(4-methylsulfanylphenyl)prop-2-enoyl]phenoxy]propyl]piperazin-1-yl]pyrimidine-2,4-dione;oxalic acid |
| SMILES | CSc1ccc(C=CC(=O)c2ccccc2OCCCN2CCN(c3cc(=O)n(C)c(=O)n3C)CC2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C29H34N4O4S.C2H2O4/c1-30-27(21-28(35)31(2)29(30)36)33-18-16-32(17-19-33)15-6-20-37-26-8-5-4-7-24(26)25(34)14-11-22-9-12-23(38-3)13-10-22;3-1(4)2(5)6/h4-5,7-14,21H,6,15-20H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | OBFFLWCNSWFMCK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 151.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.72 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|