C25H28N6O6 — CID 67839381
1,3-dimethyl-6-[4-[3-[4-nitro-2-(pyridine-3-carbonyl)phenoxy]propyl]piperazin-1-yl]pyrimidine-2,4-dione (PubChem CID 67839381) has the molecular formula C25H28N6O6 and a molecular weight of 508.54 g/mol. Its IUPAC name is 1,3-dimethyl-6-[4-[3-[4-nitro-2-(pyridine-3-carbonyl)phenoxy]propyl]piperazin-1-yl]pyrimidine-2,4-dione.
| Compound Name | 1,3-dimethyl-6-[4-[3-[4-nitro-2-(pyridine-3-carbonyl)phenoxy]propyl]piperazin-1-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 67839381 |
| Molecular Formula | C25H28N6O6 |
| Molecular Weight | 508.54 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | 1,3-dimethyl-6-[4-[3-[4-nitro-2-(pyridine-3-carbonyl)phenoxy]propyl]piperazin-1-yl]pyrimidine-2,4-dione |
| SMILES | Cn1c(N2CCN(CCCOc3ccc([N+](=O)[O-])cc3C(=O)c3cccnc3)CC2)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C25H28N6O6/c1-27-22(16-23(32)28(2)25(27)34)30-12-10-29(11-13-30)9-4-14-37-21-7-6-19(31(35)36)15-20(21)24(33)18-5-3-8-26-17-18/h3,5-8,15-17H,4,9-14H2,1-2H3 |
| InChIKey | HAMKRYMCNPRGJF-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 132.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.54 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|