C25H28N4O4 — CID 19011900
6-[4-[3-(2-benzoylphenoxy)propyl]piperazin-1-yl]-3-methyl-1H-pyrimidine-2,4-dione (PubChem CID 19011900) has the molecular formula C25H28N4O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is 6-[4-[3-(2-benzoylphenoxy)propyl]piperazin-1-yl]-3-methyl-1H-pyrimidine-2,4-dione.
| Compound Name | 6-[4-[3-(2-benzoylphenoxy)propyl]piperazin-1-yl]-3-methyl-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 19011900 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 6-[4-[3-(2-benzoylphenoxy)propyl]piperazin-1-yl]-3-methyl-1H-pyrimidine-2,4-dione |
| SMILES | Cn1c(=O)cc(N2CCN(CCCOc3ccccc3C(=O)c3ccccc3)CC2)[nH]c1=O |
| InChI | InChI=1S/C25H28N4O4/c1-27-23(30)18-22(26-25(27)32)29-15-13-28(14-16-29)12-7-17-33-21-11-6-5-10-20(21)24(31)19-8-3-2-4-9-19/h2-6,8-11,18H,7,12-17H2,1H3,(H,26,32) |
| InChIKey | WGDLAOKBSRKWFB-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 87.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|