C26H22O10 — CID 162212037
ethyl 5-[3-(2-acetyl-4-oxochromen-5-yl)oxy-2-hydroxypropoxy]-4-oxochromene-2-carboxylate (PubChem CID 162212037) has the molecular formula C26H22O10 and a molecular weight of 494.45 g/mol. Its IUPAC name is ethyl 5-[3-(2-acetyl-4-oxochromen-5-yl)oxy-2-hydroxypropoxy]-4-oxochromene-2-carboxylate.
| Compound Name | ethyl 5-[3-(2-acetyl-4-oxochromen-5-yl)oxy-2-hydroxypropoxy]-4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 162212037 |
| Molecular Formula | C26H22O10 |
| Molecular Weight | 494.45 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | ethyl 5-[3-(2-acetyl-4-oxochromen-5-yl)oxy-2-hydroxypropoxy]-4-oxochromene-2-carboxylate |
| SMILES | CCOC(=O)c1cc(=O)c2c(OCC(O)COc3cccc4oc(C(C)=O)cc(=O)c34)cccc2o1 |
| InChI | InChI=1S/C26H22O10/c1-3-32-26(31)23-11-17(30)25-19(7-5-9-21(25)36-23)34-13-15(28)12-33-18-6-4-8-20-24(18)16(29)10-22(35-20)14(2)27/h4-11,15,28H,3,12-13H2,1-2H3 |
| InChIKey | VUNIWRDJTHCBPT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 142.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |