C22H16O9 — CID 54176594
5-[2-hydroxy-3-(4-oxochromen-5-yl)oxypropoxy]-4-oxochromene-2-carboxylic acid (PubChem CID 54176594) has the molecular formula C22H16O9 and a molecular weight of 424.36 g/mol. Its IUPAC name is 5-[2-hydroxy-3-(4-oxochromen-5-yl)oxypropoxy]-4-oxochromene-2-carboxylic acid.
| Compound Name | 5-[2-hydroxy-3-(4-oxochromen-5-yl)oxypropoxy]-4-oxochromene-2-carboxylic acid |
|---|---|
| PubChem CID | 54176594 |
| Molecular Formula | C22H16O9 |
| Molecular Weight | 424.36 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | 5-[2-hydroxy-3-(4-oxochromen-5-yl)oxypropoxy]-4-oxochromene-2-carboxylic acid |
| SMILES | O=C(O)c1cc(=O)c2c(OCC(O)COc3cccc4occc(=O)c34)cccc2o1 |
| InChI | InChI=1S/C22H16O9/c23-12(10-29-16-4-1-3-15-20(16)13(24)7-8-28-15)11-30-17-5-2-6-18-21(17)14(25)9-19(31-18)22(26)27/h1-9,12,23H,10-11H2,(H,26,27) |
| InChIKey | OYVBNQQAAFDLOR-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 136.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |