C23H16NNaO11 — CID 158937732
sodium 5-[2-hydroxy-3-[2-(hydroxycarbamoyl)-4-oxochromen-5-yl]oxypropoxy]-4-oxochromene-2-carboxylate (PubChem CID 158937732) has the molecular formula C23H16NNaO11 and a molecular weight of 505.37 g/mol. Its IUPAC name is sodium 5-[2-hydroxy-3-[2-(hydroxycarbamoyl)-4-oxochromen-5-yl]oxypropoxy]-4-oxochromene-2-carboxylate.
| Compound Name | sodium 5-[2-hydroxy-3-[2-(hydroxycarbamoyl)-4-oxochromen-5-yl]oxypropoxy]-4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 158937732 |
| Molecular Formula | C23H16NNaO11 |
| Molecular Weight | 505.37 g/mol |
| Exact Mass | 505.06 |
| IUPAC Name | sodium 5-[2-hydroxy-3-[2-(hydroxycarbamoyl)-4-oxochromen-5-yl]oxypropoxy]-4-oxochromene-2-carboxylate |
| SMILES | O=C([O-])c1cc(=O)c2c(OCC(O)COc3cccc4oc(C(=O)NO)cc(=O)c34)cccc2o1.[Na+] |
| InChI | InChI=1S/C23H17NO11.Na/c25-11(10-33-15-4-2-6-17-21(15)13(27)8-19(35-17)23(29)30)9-32-14-3-1-5-16-20(14)12(26)7-18(34-16)22(28)24-31;/h1-8,11,25,31H,9-10H2,(H,24,28)(H,29,30);/q;+1/p-1 |
| InChIKey | JJWAJDDMKHSVNB-UHFFFAOYSA-M |
| XLogP | -2.80 |
| TPSA | 188.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.37 |
| LogP ≤ 5 | -2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|