C18H22O6S — CID 54397660
butyl 5-(2-hydroxy-3-methylsulfanylpropoxy)-4-oxochromene-2-carboxylate (PubChem CID 54397660) has the molecular formula C18H22O6S and a molecular weight of 366.44 g/mol. Its IUPAC name is butyl 5-(2-hydroxy-3-methylsulfanylpropoxy)-4-oxochromene-2-carboxylate.
| Compound Name | butyl 5-(2-hydroxy-3-methylsulfanylpropoxy)-4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 54397660 |
| Molecular Formula | C18H22O6S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | butyl 5-(2-hydroxy-3-methylsulfanylpropoxy)-4-oxochromene-2-carboxylate |
| SMILES | CCCCOC(=O)c1cc(=O)c2c(OCC(O)CSC)cccc2o1 |
| InChI | InChI=1S/C18H22O6S/c1-3-4-8-22-18(21)16-9-13(20)17-14(6-5-7-15(17)24-16)23-10-12(19)11-25-2/h5-7,9,12,19H,3-4,8,10-11H2,1-2H3 |
| InChIKey | VLDWZALYRQMYIC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|