C19H13Cl2NaO7 — CID 23673888
sodium 5-[3-(2,4-dichlorophenoxy)-2-hydroxypropoxy]-4-oxochromene-2-carboxylate (PubChem CID 23673888) has the molecular formula C19H13Cl2NaO7 and a molecular weight of 447.20 g/mol. Its IUPAC name is sodium 5-[3-(2,4-dichlorophenoxy)-2-hydroxypropoxy]-4-oxochromene-2-carboxylate.
| Compound Name | sodium 5-[3-(2,4-dichlorophenoxy)-2-hydroxypropoxy]-4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 23673888 |
| Molecular Formula | C19H13Cl2NaO7 |
| Molecular Weight | 447.20 g/mol |
| Exact Mass | 445.99 |
| IUPAC Name | sodium 5-[3-(2,4-dichlorophenoxy)-2-hydroxypropoxy]-4-oxochromene-2-carboxylate |
| SMILES | O=C([O-])c1cc(=O)c2c(OCC(O)COc3ccc(Cl)cc3Cl)cccc2o1.[Na+] |
| InChI | InChI=1S/C19H14Cl2O7.Na/c20-10-4-5-14(12(21)6-10)26-8-11(22)9-27-15-2-1-3-16-18(15)13(23)7-17(28-16)19(24)25;/h1-7,11,22H,8-9H2,(H,24,25);/q;+1/p-1 |
| InChIKey | MEGGTEVPULEDBZ-UHFFFAOYSA-M |
| XLogP | -0.71 |
| TPSA | 109.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.20 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |