C15H13Cl3O4S — CID 6976973
(2S)-1-(4-chlorophenyl)sulfonyl-3-(2,4-dichlorophenoxy)propan-2-ol (PubChem CID 6976973) has the molecular formula C15H13Cl3O4S and a molecular weight of 395.69 g/mol. Its IUPAC name is (2S)-1-(4-chlorophenyl)sulfonyl-3-(2,4-dichlorophenoxy)propan-2-ol.
| Compound Name | (2S)-1-(4-chlorophenyl)sulfonyl-3-(2,4-dichlorophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 6976973 |
| Molecular Formula | C15H13Cl3O4S |
| Molecular Weight | 395.69 g/mol |
| Exact Mass | 393.96 |
| IUPAC Name | (2S)-1-(4-chlorophenyl)sulfonyl-3-(2,4-dichlorophenoxy)propan-2-ol |
| SMILES | O=S(=O)(C[C@@H](O)COc1ccc(Cl)cc1Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H13Cl3O4S/c16-10-1-4-13(5-2-10)23(20,21)9-12(19)8-22-15-6-3-11(17)7-14(15)18/h1-7,12,19H,8-9H2/t12-/m0/s1 |
| InChIKey | HLHMUDOGIJQKFC-LBPRGKRZSA-N |
| XLogP | 3.86 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.69 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |