C23H25ClN2O4 — CID 54710800
7-[3-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]propoxy]-4-hydroxychromen-2-one (PubChem CID 54710800) has the molecular formula C23H25ClN2O4 and a molecular weight of 428.92 g/mol. Its IUPAC name is 7-[3-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]propoxy]-4-hydroxychromen-2-one.
| Compound Name | 7-[3-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]propoxy]-4-hydroxychromen-2-one |
|---|---|
| PubChem CID | 54710800 |
| Molecular Formula | C23H25ClN2O4 |
| Molecular Weight | 428.92 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 7-[3-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]propoxy]-4-hydroxychromen-2-one |
| SMILES | O=c1cc(O)c2ccc(OCCCN3CCN(Cc4ccc(Cl)cc4)CC3)cc2o1 |
| InChI | InChI=1S/C23H25ClN2O4/c24-18-4-2-17(3-5-18)16-26-11-9-25(10-12-26)8-1-13-29-19-6-7-20-21(27)15-23(28)30-22(20)14-19/h2-7,14-15,27H,1,8-13,16H2 |
| InChIKey | WKTIOLHKUYBBNX-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.92 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|