C22H23ClN2O3 — CID 14014437
7-[3-[4-(3-chlorophenyl)piperazin-1-yl]propoxy]chromen-2-one (PubChem CID 14014437) has the molecular formula C22H23ClN2O3 and a molecular weight of 398.89 g/mol. Its IUPAC name is 7-[3-[4-(3-chlorophenyl)piperazin-1-yl]propoxy]chromen-2-one.
| Compound Name | 7-[3-[4-(3-chlorophenyl)piperazin-1-yl]propoxy]chromen-2-one |
|---|---|
| PubChem CID | 14014437 |
| Molecular Formula | C22H23ClN2O3 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 7-[3-[4-(3-chlorophenyl)piperazin-1-yl]propoxy]chromen-2-one |
| SMILES | O=c1ccc2ccc(OCCCN3CCN(c4cccc(Cl)c4)CC3)cc2o1 |
| InChI | InChI=1S/C22H23ClN2O3/c23-18-3-1-4-19(15-18)25-12-10-24(11-13-25)9-2-14-27-20-7-5-17-6-8-22(26)28-21(17)16-20/h1,3-8,15-16H,2,9-14H2 |
| InChIKey | HWXADOPBPRQGKE-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|