C21H24ClN3O3 — CID 143892744
6-[3-[4-(4-chlorophenyl)-1,4-diazepan-1-yl]propoxy]-3H-1,3-benzoxazol-2-one (PubChem CID 143892744) has the molecular formula C21H24ClN3O3 and a molecular weight of 401.89 g/mol. Its IUPAC name is 6-[3-[4-(4-chlorophenyl)-1,4-diazepan-1-yl]propoxy]-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-[3-[4-(4-chlorophenyl)-1,4-diazepan-1-yl]propoxy]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 143892744 |
| Molecular Formula | C21H24ClN3O3 |
| Molecular Weight | 401.89 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | 6-[3-[4-(4-chlorophenyl)-1,4-diazepan-1-yl]propoxy]-3H-1,3-benzoxazol-2-one |
| SMILES | O=c1[nH]c2ccc(OCCCN3CCCN(c4ccc(Cl)cc4)CC3)cc2o1 |
| InChI | InChI=1S/C21H24ClN3O3/c22-16-3-5-17(6-4-16)25-11-1-9-24(12-13-25)10-2-14-27-18-7-8-19-20(15-18)28-21(26)23-19/h3-8,15H,1-2,9-14H2,(H,23,26) |
| InChIKey | GRXNWARRCLZSRC-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 61.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.89 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|