C21H25N3O4 — CID 25160622
6-[(2S)-2-hydroxy-3-[4-(4-methylphenyl)piperazin-1-yl]propoxy]-3H-1,3-benzoxazol-2-one (PubChem CID 25160622) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is 6-[(2S)-2-hydroxy-3-[4-(4-methylphenyl)piperazin-1-yl]propoxy]-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-[(2S)-2-hydroxy-3-[4-(4-methylphenyl)piperazin-1-yl]propoxy]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 25160622 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 6-[(2S)-2-hydroxy-3-[4-(4-methylphenyl)piperazin-1-yl]propoxy]-3H-1,3-benzoxazol-2-one |
| SMILES | Cc1ccc(N2CCN(C[C@H](O)COc3ccc4[nH]c(=O)oc4c3)CC2)cc1 |
| InChI | InChI=1S/C21H25N3O4/c1-15-2-4-16(5-3-15)24-10-8-23(9-11-24)13-17(25)14-27-18-6-7-19-20(12-18)28-21(26)22-19/h2-7,12,17,25H,8-11,13-14H2,1H3,(H,22,26)/t17-/m0/s1 |
| InChIKey | TWHPHBARCCVBKL-KRWDZBQOSA-N |
| XLogP | 1.99 |
| TPSA | 81.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|