C20H22IN3O4 — CID 70253448
6-[2-hydroxy-3-[4-(4-iodophenyl)piperazin-1-yl]propoxy]-3H-1,3-benzoxazol-2-one (PubChem CID 70253448) has the molecular formula C20H22IN3O4 and a molecular weight of 495.32 g/mol. Its IUPAC name is 6-[2-hydroxy-3-[4-(4-iodophenyl)piperazin-1-yl]propoxy]-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-[2-hydroxy-3-[4-(4-iodophenyl)piperazin-1-yl]propoxy]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 70253448 |
| Molecular Formula | C20H22IN3O4 |
| Molecular Weight | 495.32 g/mol |
| Exact Mass | 495.07 |
| IUPAC Name | 6-[2-hydroxy-3-[4-(4-iodophenyl)piperazin-1-yl]propoxy]-3H-1,3-benzoxazol-2-one |
| SMILES | O=c1[nH]c2ccc(OCC(O)CN3CCN(c4ccc(I)cc4)CC3)cc2o1 |
| InChI | InChI=1S/C20H22IN3O4/c21-14-1-3-15(4-2-14)24-9-7-23(8-10-24)12-16(25)13-27-17-5-6-18-19(11-17)28-20(26)22-18/h1-6,11,16,25H,7-10,12-13H2,(H,22,26) |
| InChIKey | WPEDFMRPZJWJJZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 81.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|