C23H26N2O3 — CID 29404351
4-[4-[(2R)-2-hydroxy-3-naphthalen-2-yloxypropyl]piperazin-1-yl]phenol (PubChem CID 29404351) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is 4-[4-[(2R)-2-hydroxy-3-naphthalen-2-yloxypropyl]piperazin-1-yl]phenol.
| Compound Name | 4-[4-[(2R)-2-hydroxy-3-naphthalen-2-yloxypropyl]piperazin-1-yl]phenol |
|---|---|
| PubChem CID | 29404351 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 4-[4-[(2R)-2-hydroxy-3-naphthalen-2-yloxypropyl]piperazin-1-yl]phenol |
| SMILES | Oc1ccc(N2CCN(C[C@@H](O)COc3ccc4ccccc4c3)CC2)cc1 |
| InChI | InChI=1S/C23H26N2O3/c26-21-8-6-20(7-9-21)25-13-11-24(12-14-25)16-22(27)17-28-23-10-5-18-3-1-2-4-19(18)15-23/h1-10,15,22,26-27H,11-14,16-17H2/t22-/m1/s1 |
| InChIKey | CSURCNIPRBSIAA-JOCHJYFZSA-N |
| XLogP | 3.11 |
| TPSA | 56.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |