C29H28ClNO4 — CID 10184881
3-(4-chlorophenyl)-7-hydroxy-4-[4-(3-piperidin-1-ylpropoxy)phenyl]chromen-2-one (PubChem CID 10184881) has the molecular formula C29H28ClNO4 and a molecular weight of 490.00 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-7-hydroxy-4-[4-(3-piperidin-1-ylpropoxy)phenyl]chromen-2-one.
| Compound Name | 3-(4-chlorophenyl)-7-hydroxy-4-[4-(3-piperidin-1-ylpropoxy)phenyl]chromen-2-one |
|---|---|
| PubChem CID | 10184881 |
| Molecular Formula | C29H28ClNO4 |
| Molecular Weight | 490.00 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | 3-(4-chlorophenyl)-7-hydroxy-4-[4-(3-piperidin-1-ylpropoxy)phenyl]chromen-2-one |
| SMILES | O=c1oc2cc(O)ccc2c(-c2ccc(OCCCN3CCCCC3)cc2)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H28ClNO4/c30-22-9-5-21(6-10-22)28-27(25-14-11-23(32)19-26(25)35-29(28)33)20-7-12-24(13-8-20)34-18-4-17-31-15-2-1-3-16-31/h5-14,19,32H,1-4,15-18H2 |
| InChIKey | CKKDTAQJZJGRBM-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.00 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|